C17H26O4 — CID 10063047
decyl 3,4-dihydroxybenzoate (PubChem CID 10063047) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is decyl 3,4-dihydroxybenzoate.
| Compound Name | decyl 3,4-dihydroxybenzoate |
|---|---|
| PubChem CID | 10063047 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | decyl 3,4-dihydroxybenzoate |
| SMILES | CCCCCCCCCCOC(=O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C17H26O4/c1-2-3-4-5-6-7-8-9-12-21-17(20)14-10-11-15(18)16(19)13-14/h10-11,13,18-19H,2-9,12H2,1H3 |
| InChIKey | IFNDOUMKRMLNES-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|