C18H26O4 — CID 86069336
decyl 4-hydroxy-5-oxocyclohepta-1,3,6-triene-1-carboxylate (PubChem CID 86069336) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is decyl 4-hydroxy-5-oxocyclohepta-1,3,6-triene-1-carboxylate.
| Compound Name | decyl 4-hydroxy-5-oxocyclohepta-1,3,6-triene-1-carboxylate |
|---|---|
| PubChem CID | 86069336 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | decyl 4-hydroxy-5-oxocyclohepta-1,3,6-triene-1-carboxylate |
| SMILES | CCCCCCCCCCOC(=O)c1ccc(O)c(=O)cc1 |
| InChI | InChI=1S/C18H26O4/c1-2-3-4-5-6-7-8-9-14-22-18(21)15-10-12-16(19)17(20)13-11-15/h10-13H,2-9,14H2,1H3,(H,19,20) |
| InChIKey | GWUPFGGAVMZJAD-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|