About 4-(4-hexoxybutoxy)butyl 4-hydroxybenzoate
4-(4-hexoxybutoxy)butyl 4-hydroxybenzoate (PubChem CID 54410325) has the molecular formula C21H34O5
and a molecular weight of 366.50 g/mol. Its IUPAC name is 4-(4-hexoxybutoxy)butyl 4-hydroxybenzoate.
Molecular Properties
| Compound Name | 4-(4-hexoxybutoxy)butyl 4-hydroxybenzoate |
| PubChem CID | 54410325 |
| Molecular Formula | C21H34O5 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | 4-(4-hexoxybutoxy)butyl 4-hydroxybenzoate |
| SMILES | CCCCCCOCCCCOCCCCOC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C21H34O5/c1-2-3-4-5-14-24-15-6-7-16-25-17-8-9-18-26-21(23)19-10-12-20(22)13-11-19/h10-13,22H,2-9,14-18H2,1H3 |
| InChIKey | VTQVXHROALOIHU-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-hexoxybutoxy)butyl 4-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-hexoxybutoxy)butyl 4-hydroxybenzoate?
The IUPAC name of 4-(4-hexoxybutoxy)butyl 4-hydroxybenzoate (CID 54410325) is 4-(4-hexoxybutoxy)butyl 4-hydroxybenzoate.
What is the SMILES notation for 4-(4-hexoxybutoxy)butyl 4-hydroxybenzoate?
The canonical SMILES for 4-(4-hexoxybutoxy)butyl 4-hydroxybenzoate is CCCCCCOCCCCOCCCCOC(=O)c1ccc(O)cc1.
What is the InChIKey of 4-(4-hexoxybutoxy)butyl 4-hydroxybenzoate?
The InChIKey is VTQVXHROALOIHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H34O5/c1-2-3-4-5-14-24-15-6-7-16-25-17-8-9-18-26-21(23)19-10-12-20(22)13-11-19/h10-13,22H,2-9,14-18H2,1H3.
What are the key properties of 4-(4-hexoxybutoxy)butyl 4-hydroxybenzoate?
4-(4-hexoxybutoxy)butyl 4-hydroxybenzoate has a molecular weight of 366.50 g/mol, XLogP of 4.72, 16 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-hexoxybutoxy)butyl 4-hydroxybenzoate is sourced from PubChem (CID 54410325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).