C11H14O3 — CID 117065204
butyl 4-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylate (PubChem CID 117065204) has the molecular formula C11H14O3 and a molecular weight of 200.18 g/mol. Its IUPAC name is butyl 4-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylate.
| Compound Name | butyl 4-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylate |
|---|---|
| PubChem CID | 117065204 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 200.18 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | butyl 4-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylate |
| SMILES | CCCCOC(=O)[13c]1[13cH][13cH][13c](O)[13cH][13cH]1 |
| InChI | InChI=1S/C11H14O3/c1-2-3-8-14-11(13)9-4-6-10(12)7-5-9/h4-7,12H,2-3,8H2,1H3/i4+1,5+1,6+1,7+1,9+1,10+1 |
| InChIKey | QFOHBWFCKVYLES-PXKSRZEUSA-N |
| XLogP | 2.35 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.18 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|