C30H36O9 — CID 118197225
butyl 4-hydroxybenzoate;ethyl 4-hydroxybenzoate;propyl 4-hydroxybenzoate (PubChem CID 118197225) has the molecular formula C30H36O9 and a molecular weight of 540.61 g/mol. Its IUPAC name is butyl 4-hydroxybenzoate;ethyl 4-hydroxybenzoate;propyl 4-hydroxybenzoate.
| Compound Name | butyl 4-hydroxybenzoate;ethyl 4-hydroxybenzoate;propyl 4-hydroxybenzoate |
|---|---|
| PubChem CID | 118197225 |
| Molecular Formula | C30H36O9 |
| Molecular Weight | 540.61 g/mol |
| Exact Mass | 540.24 |
| IUPAC Name | butyl 4-hydroxybenzoate;ethyl 4-hydroxybenzoate;propyl 4-hydroxybenzoate |
| SMILES | CCCCOC(=O)c1ccc(O)cc1.CCCOC(=O)c1ccc(O)cc1.CCOC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C11H14O3.C10H12O3.C9H10O3/c1-2-3-8-14-11(13)9-4-6-10(12)7-5-9;1-2-7-13-10(12)8-3-5-9(11)6-4-8;1-2-12-9(11)7-3-5-8(10)6-4-7/h4-7,12H,2-3,8H2,1H3;3-6,11H,2,7H2,1H3;3-6,10H,2H2,1H3 |
| InChIKey | KFOVPBPWNYIRPZ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.61 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|