About [(E)-dec-4-enyl] 4-hydroxybenzoate
[(E)-dec-4-enyl] 4-hydroxybenzoate (PubChem CID 101322255) has the molecular formula C17H24O3
and a molecular weight of 276.38 g/mol. Its IUPAC name is [(E)-dec-4-enyl] 4-hydroxybenzoate.
Molecular Properties
| Compound Name | [(E)-dec-4-enyl] 4-hydroxybenzoate |
| PubChem CID | 101322255 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | [(E)-dec-4-enyl] 4-hydroxybenzoate |
| SMILES | CCCCC/C=C/CCCOC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C17H24O3/c1-2-3-4-5-6-7-8-9-14-20-17(19)15-10-12-16(18)13-11-15/h6-7,10-13,18H,2-5,8-9,14H2,1H3/b7-6+ |
| InChIKey | XMLZSKBZVWCRED-VOTSOKGWSA-N |
| XLogP | 4.47 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(E)-dec-4-enyl] 4-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-dec-4-enyl] 4-hydroxybenzoate?
The IUPAC name of [(E)-dec-4-enyl] 4-hydroxybenzoate (CID 101322255) is [(E)-dec-4-enyl] 4-hydroxybenzoate.
What is the SMILES notation for [(E)-dec-4-enyl] 4-hydroxybenzoate?
The canonical SMILES for [(E)-dec-4-enyl] 4-hydroxybenzoate is CCCCC/C=C/CCCOC(=O)c1ccc(O)cc1.
What is the InChIKey of [(E)-dec-4-enyl] 4-hydroxybenzoate?
The InChIKey is XMLZSKBZVWCRED-VOTSOKGWSA-N. The full InChI is InChI=1S/C17H24O3/c1-2-3-4-5-6-7-8-9-14-20-17(19)15-10-12-16(18)13-11-15/h6-7,10-13,18H,2-5,8-9,14H2,1H3/b7-6+.
What are the key properties of [(E)-dec-4-enyl] 4-hydroxybenzoate?
[(E)-dec-4-enyl] 4-hydroxybenzoate has a molecular weight of 276.38 g/mol, XLogP of 4.47, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-dec-4-enyl] 4-hydroxybenzoate is sourced from PubChem (CID 101322255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).