About [(E)-heptadec-10-enyl] 4-hydroxybenzoate
[(E)-heptadec-10-enyl] 4-hydroxybenzoate (PubChem CID 101322343) has the molecular formula C24H38O3
and a molecular weight of 374.57 g/mol. Its IUPAC name is [(E)-heptadec-10-enyl] 4-hydroxybenzoate.
Molecular Properties
| Compound Name | [(E)-heptadec-10-enyl] 4-hydroxybenzoate |
| PubChem CID | 101322343 |
| Molecular Formula | C24H38O3 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.28 |
| IUPAC Name | [(E)-heptadec-10-enyl] 4-hydroxybenzoate |
| SMILES | CCCCCC/C=C/CCCCCCCCCOC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C24H38O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-21-27-24(26)22-17-19-23(25)20-18-22/h7-8,17-20,25H,2-6,9-16,21H2,1H3/b8-7+ |
| InChIKey | YFWHFFCVQMXRAC-BQYQJAHWSA-N |
| XLogP | 7.20 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(E)-heptadec-10-enyl] 4-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-heptadec-10-enyl] 4-hydroxybenzoate?
The IUPAC name of [(E)-heptadec-10-enyl] 4-hydroxybenzoate (CID 101322343) is [(E)-heptadec-10-enyl] 4-hydroxybenzoate.
What is the SMILES notation for [(E)-heptadec-10-enyl] 4-hydroxybenzoate?
The canonical SMILES for [(E)-heptadec-10-enyl] 4-hydroxybenzoate is CCCCCC/C=C/CCCCCCCCCOC(=O)c1ccc(O)cc1.
What is the InChIKey of [(E)-heptadec-10-enyl] 4-hydroxybenzoate?
The InChIKey is YFWHFFCVQMXRAC-BQYQJAHWSA-N. The full InChI is InChI=1S/C24H38O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-21-27-24(26)22-17-19-23(25)20-18-22/h7-8,17-20,25H,2-6,9-16,21H2,1H3/b8-7+.
What are the key properties of [(E)-heptadec-10-enyl] 4-hydroxybenzoate?
[(E)-heptadec-10-enyl] 4-hydroxybenzoate has a molecular weight of 374.57 g/mol, XLogP of 7.20, 16 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-heptadec-10-enyl] 4-hydroxybenzoate is sourced from PubChem (CID 101322343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).