About 2-[bis(2-hydroxyethyl)amino]ethanol;butyl 4-hydroxybenzoate
2-[bis(2-hydroxyethyl)amino]ethanol;butyl 4-hydroxybenzoate (PubChem CID 158298173) has the molecular formula C17H29NO6
and a molecular weight of 343.42 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)amino]ethanol;butyl 4-hydroxybenzoate.
Molecular Properties
| Compound Name | 2-[bis(2-hydroxyethyl)amino]ethanol;butyl 4-hydroxybenzoate |
| PubChem CID | 158298173 |
| Molecular Formula | C17H29NO6 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]ethanol;butyl 4-hydroxybenzoate |
| SMILES | CCCCOC(=O)c1ccc(O)cc1.OCCN(CCO)CCO |
| InChI | InChI=1S/C11H14O3.C6H15NO3/c1-2-3-8-14-11(13)9-4-6-10(12)7-5-9;8-4-1-7(2-5-9)3-6-10/h4-7,12H,2-3,8H2,1H3;8-10H,1-6H2 |
| InChIKey | GMEAITWWFMBLCI-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[bis(2-hydroxyethyl)amino]ethanol;butyl 4-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bis(2-hydroxyethyl)amino]ethanol;butyl 4-hydroxybenzoate?
The IUPAC name of 2-[bis(2-hydroxyethyl)amino]ethanol;butyl 4-hydroxybenzoate (CID 158298173) is 2-[bis(2-hydroxyethyl)amino]ethanol;butyl 4-hydroxybenzoate.
What is the SMILES notation for 2-[bis(2-hydroxyethyl)amino]ethanol;butyl 4-hydroxybenzoate?
The canonical SMILES for 2-[bis(2-hydroxyethyl)amino]ethanol;butyl 4-hydroxybenzoate is CCCCOC(=O)c1ccc(O)cc1.OCCN(CCO)CCO.
What is the InChIKey of 2-[bis(2-hydroxyethyl)amino]ethanol;butyl 4-hydroxybenzoate?
The InChIKey is GMEAITWWFMBLCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O3.C6H15NO3/c1-2-3-8-14-11(13)9-4-6-10(12)7-5-9;8-4-1-7(2-5-9)3-6-10/h4-7,12H,2-3,8H2,1H3;8-10H,1-6H2.
What are the key properties of 2-[bis(2-hydroxyethyl)amino]ethanol;butyl 4-hydroxybenzoate?
2-[bis(2-hydroxyethyl)amino]ethanol;butyl 4-hydroxybenzoate has a molecular weight of 343.42 g/mol, XLogP of 0.61, 10 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis(2-hydroxyethyl)amino]ethanol;butyl 4-hydroxybenzoate is sourced from PubChem (CID 158298173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).