About 10-(4-hydroxybenzoyl)oxydecyl 4-hydroxybenzoate
10-(4-hydroxybenzoyl)oxydecyl 4-hydroxybenzoate (PubChem CID 3896266) has the molecular formula C24H30O6
and a molecular weight of 414.50 g/mol. Its IUPAC name is 10-(4-hydroxybenzoyl)oxydecyl 4-hydroxybenzoate.
Molecular Properties
| Compound Name | 10-(4-hydroxybenzoyl)oxydecyl 4-hydroxybenzoate |
| PubChem CID | 3896266 |
| Molecular Formula | C24H30O6 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | 10-(4-hydroxybenzoyl)oxydecyl 4-hydroxybenzoate |
| SMILES | O=C(OCCCCCCCCCCOC(=O)c1ccc(O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C24H30O6/c25-21-13-9-19(10-14-21)23(27)29-17-7-5-3-1-2-4-6-8-18-30-24(28)20-11-15-22(26)16-12-20/h9-16,25-26H,1-8,17-18H2 |
| InChIKey | AAIYZNZVJSEINM-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 10-(4-hydroxybenzoyl)oxydecyl 4-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-(4-hydroxybenzoyl)oxydecyl 4-hydroxybenzoate?
The IUPAC name of 10-(4-hydroxybenzoyl)oxydecyl 4-hydroxybenzoate (CID 3896266) is 10-(4-hydroxybenzoyl)oxydecyl 4-hydroxybenzoate.
What is the SMILES notation for 10-(4-hydroxybenzoyl)oxydecyl 4-hydroxybenzoate?
The canonical SMILES for 10-(4-hydroxybenzoyl)oxydecyl 4-hydroxybenzoate is O=C(OCCCCCCCCCCOC(=O)c1ccc(O)cc1)c1ccc(O)cc1.
What is the InChIKey of 10-(4-hydroxybenzoyl)oxydecyl 4-hydroxybenzoate?
The InChIKey is AAIYZNZVJSEINM-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30O6/c25-21-13-9-19(10-14-21)23(27)29-17-7-5-3-1-2-4-6-8-18-30-24(28)20-11-15-22(26)16-12-20/h9-16,25-26H,1-8,17-18H2.
What are the key properties of 10-(4-hydroxybenzoyl)oxydecyl 4-hydroxybenzoate?
10-(4-hydroxybenzoyl)oxydecyl 4-hydroxybenzoate has a molecular weight of 414.50 g/mol, XLogP of 5.23, 13 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 10-(4-hydroxybenzoyl)oxydecyl 4-hydroxybenzoate is sourced from PubChem (CID 3896266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).