C14H18N4O2 — CID 162666897
4-(diaminomethylideneamino)butyl 1H-indole-5-carboxylate (PubChem CID 162666897) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is 4-(diaminomethylideneamino)butyl 1H-indole-5-carboxylate.
| Compound Name | 4-(diaminomethylideneamino)butyl 1H-indole-5-carboxylate |
|---|---|
| PubChem CID | 162666897 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 4-(diaminomethylideneamino)butyl 1H-indole-5-carboxylate |
| SMILES | NC(N)=NCCCCOC(=O)c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C14H18N4O2/c15-14(16)18-6-1-2-8-20-13(19)11-3-4-12-10(9-11)5-7-17-12/h3-5,7,9,17H,1-2,6,8H2,(H4,15,16,18) |
| InChIKey | GZJVZUADRNMHPO-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|