C12H18N6O2 — CID 155524176
3-(diaminomethylideneamino)propyl 4-(diaminomethylideneamino)benzoate (PubChem CID 155524176) has the molecular formula C12H18N6O2 and a molecular weight of 278.32 g/mol. Its IUPAC name is 3-(diaminomethylideneamino)propyl 4-(diaminomethylideneamino)benzoate.
| Compound Name | 3-(diaminomethylideneamino)propyl 4-(diaminomethylideneamino)benzoate |
|---|---|
| PubChem CID | 155524176 |
| Molecular Formula | C12H18N6O2 |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 3-(diaminomethylideneamino)propyl 4-(diaminomethylideneamino)benzoate |
| SMILES | NC(N)=NCCCOC(=O)c1ccc(N=C(N)N)cc1 |
| InChI | InChI=1S/C12H18N6O2/c13-11(14)17-6-1-7-20-10(19)8-2-4-9(5-3-8)18-12(15)16/h2-5H,1,6-7H2,(H4,13,14,17)(H4,15,16,18) |
| InChIKey | GPOYOBOURQLEKM-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 155.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|