C15H18Cl2N6O — CID 90664982
2-[4-[4-(diaminomethylideneamino)benzoyl]phenyl]guanidine;dihydrochloride (PubChem CID 90664982) has the molecular formula C15H18Cl2N6O and a molecular weight of 369.26 g/mol. Its IUPAC name is 2-[4-[4-(diaminomethylideneamino)benzoyl]phenyl]guanidine;dihydrochloride.
| Compound Name | 2-[4-[4-(diaminomethylideneamino)benzoyl]phenyl]guanidine;dihydrochloride |
|---|---|
| PubChem CID | 90664982 |
| Molecular Formula | C15H18Cl2N6O |
| Molecular Weight | 369.26 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 2-[4-[4-(diaminomethylideneamino)benzoyl]phenyl]guanidine;dihydrochloride |
| SMILES | Cl.Cl.NC(N)=Nc1ccc(C(=O)c2ccc(N=C(N)N)cc2)cc1 |
| InChI | InChI=1S/C15H16N6O.2ClH/c16-14(17)20-11-5-1-9(2-6-11)13(22)10-3-7-12(8-4-10)21-15(18)19;;/h1-8H,(H4,16,17,20)(H4,18,19,21);2*1H |
| InChIKey | BDYCMTKCHWYHPW-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 145.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.26 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|