About 4-(diaminomethylideneamino)benzoic acid;(4-nitrophenyl)-phenylmethanone
4-(diaminomethylideneamino)benzoic acid;(4-nitrophenyl)-phenylmethanone (PubChem CID 175322843) has the molecular formula C21H18N4O5
and a molecular weight of 406.40 g/mol. Its IUPAC name is 4-(diaminomethylideneamino)benzoic acid;(4-nitrophenyl)-phenylmethanone.
Molecular Properties
| Compound Name | 4-(diaminomethylideneamino)benzoic acid;(4-nitrophenyl)-phenylmethanone |
| PubChem CID | 175322843 |
| Molecular Formula | C21H18N4O5 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 4-(diaminomethylideneamino)benzoic acid;(4-nitrophenyl)-phenylmethanone |
| SMILES | NC(N)=Nc1ccc(C(=O)O)cc1.O=C(c1ccccc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H9NO3.C8H9N3O2/c15-13(10-4-2-1-3-5-10)11-6-8-12(9-7-11)14(16)17;9-8(10)11-6-3-1-5(2-4-6)7(12)13/h1-9H;1-4H,(H,12,13)(H4,9,10,11) |
| InChIKey | CUYIFEVTOZFZCM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 161.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(diaminomethylideneamino)benzoic acid;(4-nitrophenyl)-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(diaminomethylideneamino)benzoic acid;(4-nitrophenyl)-phenylmethanone?
The IUPAC name of 4-(diaminomethylideneamino)benzoic acid;(4-nitrophenyl)-phenylmethanone (CID 175322843) is 4-(diaminomethylideneamino)benzoic acid;(4-nitrophenyl)-phenylmethanone.
What is the SMILES notation for 4-(diaminomethylideneamino)benzoic acid;(4-nitrophenyl)-phenylmethanone?
The canonical SMILES for 4-(diaminomethylideneamino)benzoic acid;(4-nitrophenyl)-phenylmethanone is NC(N)=Nc1ccc(C(=O)O)cc1.O=C(c1ccccc1)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 4-(diaminomethylideneamino)benzoic acid;(4-nitrophenyl)-phenylmethanone?
The InChIKey is CUYIFEVTOZFZCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO3.C8H9N3O2/c15-13(10-4-2-1-3-5-10)11-6-8-12(9-7-11)14(16)17;9-8(10)11-6-3-1-5(2-4-6)7(12)13/h1-9H;1-4H,(H,12,13)(H4,9,10,11).
What are the key properties of 4-(diaminomethylideneamino)benzoic acid;(4-nitrophenyl)-phenylmethanone?
4-(diaminomethylideneamino)benzoic acid;(4-nitrophenyl)-phenylmethanone has a molecular weight of 406.40 g/mol, XLogP of 3.12, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(diaminomethylideneamino)benzoic acid;(4-nitrophenyl)-phenylmethanone is sourced from PubChem (CID 175322843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).