About (4-nitrophenyl)-phenylmethanone;propyl carbamate
(4-nitrophenyl)-phenylmethanone;propyl carbamate (PubChem CID 174494585) has the molecular formula C17H18N2O5
and a molecular weight of 330.34 g/mol. Its IUPAC name is (4-nitrophenyl)-phenylmethanone;propyl carbamate.
Molecular Properties
| Compound Name | (4-nitrophenyl)-phenylmethanone;propyl carbamate |
| PubChem CID | 174494585 |
| Molecular Formula | C17H18N2O5 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | (4-nitrophenyl)-phenylmethanone;propyl carbamate |
| SMILES | CCCOC(N)=O.O=C(c1ccccc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H9NO3.C4H9NO2/c15-13(10-4-2-1-3-5-10)11-6-8-12(9-7-11)14(16)17;1-2-3-7-4(5)6/h1-9H;2-3H2,1H3,(H2,5,6) |
| InChIKey | CDMXDIQYONYWNL-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 112.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-nitrophenyl)-phenylmethanone;propyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitrophenyl)-phenylmethanone;propyl carbamate?
The IUPAC name of (4-nitrophenyl)-phenylmethanone;propyl carbamate (CID 174494585) is (4-nitrophenyl)-phenylmethanone;propyl carbamate.
What is the SMILES notation for (4-nitrophenyl)-phenylmethanone;propyl carbamate?
The canonical SMILES for (4-nitrophenyl)-phenylmethanone;propyl carbamate is CCCOC(N)=O.O=C(c1ccccc1)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of (4-nitrophenyl)-phenylmethanone;propyl carbamate?
The InChIKey is CDMXDIQYONYWNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO3.C4H9NO2/c15-13(10-4-2-1-3-5-10)11-6-8-12(9-7-11)14(16)17;1-2-3-7-4(5)6/h1-9H;2-3H2,1H3,(H2,5,6).
What are the key properties of (4-nitrophenyl)-phenylmethanone;propyl carbamate?
(4-nitrophenyl)-phenylmethanone;propyl carbamate has a molecular weight of 330.34 g/mol, XLogP of 3.32, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitrophenyl)-phenylmethanone;propyl carbamate is sourced from PubChem (CID 174494585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).