About (4-nitrophenyl)-phenylmethanone;tetradecanoic acid
(4-nitrophenyl)-phenylmethanone;tetradecanoic acid (PubChem CID 174904568) has the molecular formula C27H37NO5
and a molecular weight of 455.60 g/mol. Its IUPAC name is (4-nitrophenyl)-phenylmethanone;tetradecanoic acid.
Molecular Properties
| Compound Name | (4-nitrophenyl)-phenylmethanone;tetradecanoic acid |
| PubChem CID | 174904568 |
| Molecular Formula | C27H37NO5 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.27 |
| IUPAC Name | (4-nitrophenyl)-phenylmethanone;tetradecanoic acid |
| SMILES | CCCCCCCCCCCCCC(=O)O.O=C(c1ccccc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H28O2.C13H9NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16;15-13(10-4-2-1-3-5-10)11-6-8-12(9-7-11)14(16)17/h2-13H2,1H3,(H,15,16);1-9H |
| InChIKey | QGVTVEPWGDXNMJ-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 97.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-nitrophenyl)-phenylmethanone;tetradecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitrophenyl)-phenylmethanone;tetradecanoic acid?
The IUPAC name of (4-nitrophenyl)-phenylmethanone;tetradecanoic acid (CID 174904568) is (4-nitrophenyl)-phenylmethanone;tetradecanoic acid.
What is the SMILES notation for (4-nitrophenyl)-phenylmethanone;tetradecanoic acid?
The canonical SMILES for (4-nitrophenyl)-phenylmethanone;tetradecanoic acid is CCCCCCCCCCCCCC(=O)O.O=C(c1ccccc1)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of (4-nitrophenyl)-phenylmethanone;tetradecanoic acid?
The InChIKey is QGVTVEPWGDXNMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O2.C13H9NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16;15-13(10-4-2-1-3-5-10)11-6-8-12(9-7-11)14(16)17/h2-13H2,1H3,(H,15,16);1-9H.
What are the key properties of (4-nitrophenyl)-phenylmethanone;tetradecanoic acid?
(4-nitrophenyl)-phenylmethanone;tetradecanoic acid has a molecular weight of 455.60 g/mol, XLogP of 7.60, 15 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitrophenyl)-phenylmethanone;tetradecanoic acid is sourced from PubChem (CID 174904568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).