About (4-nitrophenyl)-phenylmethanone;plutonium;propyl carbonate
(4-nitrophenyl)-phenylmethanone;plutonium;propyl carbonate (PubChem CID 160736734) has the molecular formula C29H37NO15Pu-4
and a molecular weight of 883.61 g/mol. Its IUPAC name is (4-nitrophenyl)-phenylmethanone;plutonium;propyl carbonate.
Molecular Properties
| Compound Name | (4-nitrophenyl)-phenylmethanone;plutonium;propyl carbonate |
| PubChem CID | 160736734 |
| Molecular Formula | C29H37NO15Pu-4 |
| Molecular Weight | 883.61 g/mol |
| Exact Mass | 877.27 |
| IUPAC Name | (4-nitrophenyl)-phenylmethanone;plutonium;propyl carbonate |
| SMILES | CCCOC(=O)[O-].CCCOC(=O)[O-].CCCOC(=O)[O-].CCCOC(=O)[O-].O=C(c1ccccc1)c1ccc([N+](=O)[O-])cc1.[Pu] |
| InChI | InChI=1S/C13H9NO3.4C4H8O3.Pu/c15-13(10-4-2-1-3-5-10)11-6-8-12(9-7-11)14(16)17;4*1-2-3-7-4(5)6;/h1-9H;4*2-3H2,1H3,(H,5,6);/p-4 |
| InChIKey | BKSMEHIIJJSEGX-UHFFFAOYSA-J |
| XLogP | 1.85 |
| TPSA | 257.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 883.61 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-nitrophenyl)-phenylmethanone;plutonium;propyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitrophenyl)-phenylmethanone;plutonium;propyl carbonate?
The IUPAC name of (4-nitrophenyl)-phenylmethanone;plutonium;propyl carbonate (CID 160736734) is (4-nitrophenyl)-phenylmethanone;plutonium;propyl carbonate.
What is the SMILES notation for (4-nitrophenyl)-phenylmethanone;plutonium;propyl carbonate?
The canonical SMILES for (4-nitrophenyl)-phenylmethanone;plutonium;propyl carbonate is CCCOC(=O)[O-].CCCOC(=O)[O-].CCCOC(=O)[O-].CCCOC(=O)[O-].O=C(c1ccccc1)c1ccc([N+](=O)[O-])cc1.[Pu].
What is the InChIKey of (4-nitrophenyl)-phenylmethanone;plutonium;propyl carbonate?
The InChIKey is BKSMEHIIJJSEGX-UHFFFAOYSA-J. The full InChI is InChI=1S/C13H9NO3.4C4H8O3.Pu/c15-13(10-4-2-1-3-5-10)11-6-8-12(9-7-11)14(16)17;4*1-2-3-7-4(5)6;/h1-9H;4*2-3H2,1H3,(H,5,6);/p-4.
What are the key properties of (4-nitrophenyl)-phenylmethanone;plutonium;propyl carbonate?
(4-nitrophenyl)-phenylmethanone;plutonium;propyl carbonate has a molecular weight of 883.61 g/mol, XLogP of 1.85, 11 rotatable bonds, 0 hydrogen bond donors, and 15 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitrophenyl)-phenylmethanone;plutonium;propyl carbonate is sourced from PubChem (CID 160736734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).