About diphenylmethanone;1-methyl-4-nitrobenzene
diphenylmethanone;1-methyl-4-nitrobenzene (PubChem CID 160968328) has the molecular formula C20H17NO3
and a molecular weight of 319.36 g/mol. Its IUPAC name is diphenylmethanone;1-methyl-4-nitrobenzene.
Molecular Properties
| Compound Name | diphenylmethanone;1-methyl-4-nitrobenzene |
| PubChem CID | 160968328 |
| Molecular Formula | C20H17NO3 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | diphenylmethanone;1-methyl-4-nitrobenzene |
| SMILES | Cc1ccc([N+](=O)[O-])cc1.O=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H10O.C7H7NO2/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-6-2-4-7(5-3-6)8(9)10/h1-10H;2-5H,1H3 |
| InChIKey | SXXMVNYOHTVCNV-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze diphenylmethanone;1-methyl-4-nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylmethanone;1-methyl-4-nitrobenzene?
The IUPAC name of diphenylmethanone;1-methyl-4-nitrobenzene (CID 160968328) is diphenylmethanone;1-methyl-4-nitrobenzene.
What is the SMILES notation for diphenylmethanone;1-methyl-4-nitrobenzene?
The canonical SMILES for diphenylmethanone;1-methyl-4-nitrobenzene is Cc1ccc([N+](=O)[O-])cc1.O=C(c1ccccc1)c1ccccc1.
What is the InChIKey of diphenylmethanone;1-methyl-4-nitrobenzene?
The InChIKey is SXXMVNYOHTVCNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O.C7H7NO2/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-6-2-4-7(5-3-6)8(9)10/h1-10H;2-5H,1H3.
What are the key properties of diphenylmethanone;1-methyl-4-nitrobenzene?
diphenylmethanone;1-methyl-4-nitrobenzene has a molecular weight of 319.36 g/mol, XLogP of 4.82, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylmethanone;1-methyl-4-nitrobenzene is sourced from PubChem (CID 160968328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).