C29H23NO4 — CID 122386072
2-(4-methylphenyl)-3-(4-nitrophenyl)-1,4-diphenylbutane-1,4-dione (PubChem CID 122386072) has the molecular formula C29H23NO4 and a molecular weight of 449.51 g/mol. Its IUPAC name is 2-(4-methylphenyl)-3-(4-nitrophenyl)-1,4-diphenylbutane-1,4-dione.
| Compound Name | 2-(4-methylphenyl)-3-(4-nitrophenyl)-1,4-diphenylbutane-1,4-dione |
|---|---|
| PubChem CID | 122386072 |
| Molecular Formula | C29H23NO4 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 2-(4-methylphenyl)-3-(4-nitrophenyl)-1,4-diphenylbutane-1,4-dione |
| SMILES | Cc1ccc(C(C(=O)c2ccccc2)C(C(=O)c2ccccc2)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C29H23NO4/c1-20-12-14-21(15-13-20)26(28(31)23-8-4-2-5-9-23)27(29(32)24-10-6-3-7-11-24)22-16-18-25(19-17-22)30(33)34/h2-19,26-27H,1H3 |
| InChIKey | BXWNVXURAIMMDX-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|