About benzenethiol;1-methyl-4-nitrobenzene
benzenethiol;1-methyl-4-nitrobenzene (PubChem CID 159323045) has the molecular formula C13H13NO2S
and a molecular weight of 247.32 g/mol. Its IUPAC name is benzenethiol;1-methyl-4-nitrobenzene.
Molecular Properties
| Compound Name | benzenethiol;1-methyl-4-nitrobenzene |
| PubChem CID | 159323045 |
| Molecular Formula | C13H13NO2S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | benzenethiol;1-methyl-4-nitrobenzene |
| SMILES | Cc1ccc([N+](=O)[O-])cc1.Sc1ccccc1 |
| InChI | InChI=1S/C7H7NO2.C6H6S/c1-6-2-4-7(5-3-6)8(9)10;7-6-4-2-1-3-5-6/h2-5H,1H3;1-5,7H |
| InChIKey | LDZUWIJVAXNLCV-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 43.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze benzenethiol;1-methyl-4-nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenethiol;1-methyl-4-nitrobenzene?
The IUPAC name of benzenethiol;1-methyl-4-nitrobenzene (CID 159323045) is benzenethiol;1-methyl-4-nitrobenzene.
What is the SMILES notation for benzenethiol;1-methyl-4-nitrobenzene?
The canonical SMILES for benzenethiol;1-methyl-4-nitrobenzene is Cc1ccc([N+](=O)[O-])cc1.Sc1ccccc1.
What is the InChIKey of benzenethiol;1-methyl-4-nitrobenzene?
The InChIKey is LDZUWIJVAXNLCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2.C6H6S/c1-6-2-4-7(5-3-6)8(9)10;7-6-4-2-1-3-5-6/h2-5H,1H3;1-5,7H.
What are the key properties of benzenethiol;1-methyl-4-nitrobenzene?
benzenethiol;1-methyl-4-nitrobenzene has a molecular weight of 247.32 g/mol, XLogP of 3.88, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzenethiol;1-methyl-4-nitrobenzene is sourced from PubChem (CID 159323045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).