About CID 136734347
CID 136734347 (PubChem CID 136734347) has the molecular formula C12H10HgNO2S+
and a molecular weight of 432.87 g/mol.
Molecular Properties
| Compound Name | CID 136734347 |
| PubChem CID | 136734347 |
| Molecular Formula | C12H10HgNO2S+ |
| Molecular Weight | 432.87 g/mol |
| Exact Mass | 434.01 |
| IUPAC Name | — |
| SMILES | O=[N+]([O-])c1ccc(S)cc1.[Hg+].[c]1ccccc1 |
| InChI | InChI=1S/C6H5NO2S.C6H5.Hg/c8-7(9)5-1-3-6(10)4-2-5;1-2-4-6-5-3-1;/h1-4,10H;1-5H;/q;;+1 |
| InChIKey | JPFMZORXYGOHIY-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 43.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.87 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze CID 136734347 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 136734347?
The IUPAC name of CID 136734347 (CID 136734347) is not available.
What is the SMILES notation for CID 136734347?
The canonical SMILES for CID 136734347 is O=[N+]([O-])c1ccc(S)cc1.[Hg+].[c]1ccccc1.
What is the InChIKey of CID 136734347?
The InChIKey is JPFMZORXYGOHIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO2S.C6H5.Hg/c8-7(9)5-1-3-6(10)4-2-5;1-2-4-6-5-3-1;/h1-4,10H;1-5H;/q;;+1.
What are the key properties of CID 136734347?
CID 136734347 has a molecular weight of 432.87 g/mol, XLogP of 3.37, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 136734347 is sourced from PubChem (CID 136734347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).