About azane;nitrobenzene
azane;nitrobenzene (PubChem CID 23197461) has the molecular formula C6H8N2O2
and a molecular weight of 140.14 g/mol. Its IUPAC name is azane;nitrobenzene.
Molecular Properties
| Compound Name | azane;nitrobenzene |
| PubChem CID | 23197461 |
| Molecular Formula | C6H8N2O2 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.06 |
| IUPAC Name | azane;nitrobenzene |
| SMILES | N.O=[N+]([O-])c1ccccc1 |
| InChI | InChI=1S/C6H5NO2.H3N/c8-7(9)6-4-2-1-3-5-6;/h1-5H;1H3 |
| InChIKey | ADMVIFRMWYPPSZ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 78.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze azane;nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;nitrobenzene?
The IUPAC name of azane;nitrobenzene (CID 23197461) is azane;nitrobenzene.
What is the SMILES notation for azane;nitrobenzene?
The canonical SMILES for azane;nitrobenzene is N.O=[N+]([O-])c1ccccc1.
What is the InChIKey of azane;nitrobenzene?
The InChIKey is ADMVIFRMWYPPSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO2.H3N/c8-7(9)6-4-2-1-3-5-6;/h1-5H;1H3.
What are the key properties of azane;nitrobenzene?
azane;nitrobenzene has a molecular weight of 140.14 g/mol, XLogP of 1.76, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;nitrobenzene is sourced from PubChem (CID 23197461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).