About arsane;nitrobenzene
arsane;nitrobenzene (PubChem CID 174282180) has the molecular formula C6H8AsNO2
and a molecular weight of 201.06 g/mol. Its IUPAC name is arsane;nitrobenzene.
Molecular Properties
| Compound Name | arsane;nitrobenzene |
| PubChem CID | 174282180 |
| Molecular Formula | C6H8AsNO2 |
| Molecular Weight | 201.06 g/mol |
| Exact Mass | 200.98 |
| IUPAC Name | arsane;nitrobenzene |
| SMILES | O=[N+]([O-])c1ccccc1.[AsH3] |
| InChI | InChI=1S/C6H5NO2.AsH3/c8-7(9)6-4-2-1-3-5-6;/h1-5H;1H3 |
| InChIKey | ZABOLBLTWABMRU-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.06 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze arsane;nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of arsane;nitrobenzene?
The IUPAC name of arsane;nitrobenzene (CID 174282180) is arsane;nitrobenzene.
What is the SMILES notation for arsane;nitrobenzene?
The canonical SMILES for arsane;nitrobenzene is O=[N+]([O-])c1ccccc1.[AsH3].
What is the InChIKey of arsane;nitrobenzene?
The InChIKey is ZABOLBLTWABMRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO2.AsH3/c8-7(9)6-4-2-1-3-5-6;/h1-5H;1H3.
What are the key properties of arsane;nitrobenzene?
arsane;nitrobenzene has a molecular weight of 201.06 g/mol, XLogP of 0.41, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for arsane;nitrobenzene is sourced from PubChem (CID 174282180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).