About azanium nitrobenzene
azanium nitrobenzene (PubChem CID 22989049) has the molecular formula C6H9N2O2+
and a molecular weight of 141.15 g/mol. Its IUPAC name is azanium nitrobenzene.
Molecular Properties
| Compound Name | azanium nitrobenzene |
| PubChem CID | 22989049 |
| Molecular Formula | C6H9N2O2+ |
| Molecular Weight | 141.15 g/mol |
| Exact Mass | 141.07 |
| IUPAC Name | azanium nitrobenzene |
| SMILES | O=[N+]([O-])c1ccccc1.[NH4+] |
| InChI | InChI=1S/C6H5NO2.H3N/c8-7(9)6-4-2-1-3-5-6;/h1-5H;1H3/p+1 |
| InChIKey | ADMVIFRMWYPPSZ-UHFFFAOYSA-O |
| XLogP | 1.97 |
| TPSA | 79.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.15 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze azanium nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium nitrobenzene?
The IUPAC name of azanium nitrobenzene (CID 22989049) is azanium nitrobenzene.
What is the SMILES notation for azanium nitrobenzene?
The canonical SMILES for azanium nitrobenzene is O=[N+]([O-])c1ccccc1.[NH4+].
What is the InChIKey of azanium nitrobenzene?
The InChIKey is ADMVIFRMWYPPSZ-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H5NO2.H3N/c8-7(9)6-4-2-1-3-5-6;/h1-5H;1H3/p+1.
What are the key properties of azanium nitrobenzene?
azanium nitrobenzene has a molecular weight of 141.15 g/mol, XLogP of 1.97, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azanium nitrobenzene is sourced from PubChem (CID 22989049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).