About benzene;iron;nitrobenzene
benzene;iron;nitrobenzene (PubChem CID 174446919) has the molecular formula C12H11FeNO2
and a molecular weight of 257.07 g/mol. Its IUPAC name is benzene;iron;nitrobenzene.
Molecular Properties
| Compound Name | benzene;iron;nitrobenzene |
| PubChem CID | 174446919 |
| Molecular Formula | C12H11FeNO2 |
| Molecular Weight | 257.07 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | benzene;iron;nitrobenzene |
| SMILES | O=[N+]([O-])c1ccccc1.[Fe].c1ccccc1 |
| InChI | InChI=1S/C6H5NO2.C6H6.Fe/c8-7(9)6-4-2-1-3-5-6;1-2-4-6-5-3-1;/h1-5H;1-6H; |
| InChIKey | OEDLHFBDQBHIHD-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.07 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzene;iron;nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;iron;nitrobenzene?
The IUPAC name of benzene;iron;nitrobenzene (CID 174446919) is benzene;iron;nitrobenzene.
What is the SMILES notation for benzene;iron;nitrobenzene?
The canonical SMILES for benzene;iron;nitrobenzene is O=[N+]([O-])c1ccccc1.[Fe].c1ccccc1.
What is the InChIKey of benzene;iron;nitrobenzene?
The InChIKey is OEDLHFBDQBHIHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO2.C6H6.Fe/c8-7(9)6-4-2-1-3-5-6;1-2-4-6-5-3-1;/h1-5H;1-6H;.
What are the key properties of benzene;iron;nitrobenzene?
benzene;iron;nitrobenzene has a molecular weight of 257.07 g/mol, XLogP of 3.28, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;iron;nitrobenzene is sourced from PubChem (CID 174446919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).