About carbon dioxide;nitrobenzene
carbon dioxide;nitrobenzene (PubChem CID 163592574) has the molecular formula C7H5NO4
and a molecular weight of 167.12 g/mol. Its IUPAC name is carbon dioxide;nitrobenzene.
Molecular Properties
| Compound Name | carbon dioxide;nitrobenzene |
| PubChem CID | 163592574 |
| Molecular Formula | C7H5NO4 |
| Molecular Weight | 167.12 g/mol |
| Exact Mass | 167.02 |
| IUPAC Name | carbon dioxide;nitrobenzene |
| SMILES | O=C=O.O=[N+]([O-])c1ccccc1 |
| InChI | InChI=1S/C6H5NO2.CO2/c8-7(9)6-4-2-1-3-5-6;2-1-3/h1-5H; |
| InChIKey | GQSQRUJWPQGGCW-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.12 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze carbon dioxide;nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon dioxide;nitrobenzene?
The IUPAC name of carbon dioxide;nitrobenzene (CID 163592574) is carbon dioxide;nitrobenzene.
What is the SMILES notation for carbon dioxide;nitrobenzene?
The canonical SMILES for carbon dioxide;nitrobenzene is O=C=O.O=[N+]([O-])c1ccccc1.
What is the InChIKey of carbon dioxide;nitrobenzene?
The InChIKey is GQSQRUJWPQGGCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO2.CO2/c8-7(9)6-4-2-1-3-5-6;2-1-3/h1-5H;.
What are the key properties of carbon dioxide;nitrobenzene?
carbon dioxide;nitrobenzene has a molecular weight of 167.12 g/mol, XLogP of 1.01, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;nitrobenzene is sourced from PubChem (CID 163592574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).