About carbonic acid;nitrobenzene
carbonic acid;nitrobenzene (PubChem CID 158100196) has the molecular formula C13H12N2O7
and a molecular weight of 308.25 g/mol. Its IUPAC name is carbonic acid;nitrobenzene.
Molecular Properties
| Compound Name | carbonic acid;nitrobenzene |
| PubChem CID | 158100196 |
| Molecular Formula | C13H12N2O7 |
| Molecular Weight | 308.25 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | carbonic acid;nitrobenzene |
| SMILES | O=C(O)O.O=[N+]([O-])c1ccccc1.O=[N+]([O-])c1ccccc1 |
| InChI | InChI=1S/2C6H5NO2.CH2O3/c2*8-7(9)6-4-2-1-3-5-6;2-1(3)4/h2*1-5H;(H2,2,3,4) |
| InChIKey | FPDWHGAQJGAILQ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 143.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.25 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze carbonic acid;nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonic acid;nitrobenzene?
The IUPAC name of carbonic acid;nitrobenzene (CID 158100196) is carbonic acid;nitrobenzene.
What is the SMILES notation for carbonic acid;nitrobenzene?
The canonical SMILES for carbonic acid;nitrobenzene is O=C(O)O.O=[N+]([O-])c1ccccc1.O=[N+]([O-])c1ccccc1.
What is the InChIKey of carbonic acid;nitrobenzene?
The InChIKey is FPDWHGAQJGAILQ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H5NO2.CH2O3/c2*8-7(9)6-4-2-1-3-5-6;2-1(3)4/h2*1-5H;(H2,2,3,4).
What are the key properties of carbonic acid;nitrobenzene?
carbonic acid;nitrobenzene has a molecular weight of 308.25 g/mol, XLogP of 3.41, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;nitrobenzene is sourced from PubChem (CID 158100196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).