About carbamic acid;nitrobenzene
carbamic acid;nitrobenzene (PubChem CID 66874578) has the molecular formula C7H8N2O4
and a molecular weight of 184.15 g/mol. Its IUPAC name is carbamic acid;nitrobenzene.
Molecular Properties
| Compound Name | carbamic acid;nitrobenzene |
| PubChem CID | 66874578 |
| Molecular Formula | C7H8N2O4 |
| Molecular Weight | 184.15 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | carbamic acid;nitrobenzene |
| SMILES | NC(=O)O.O=[N+]([O-])c1ccccc1 |
| InChI | InChI=1S/C6H5NO2.CH3NO2/c8-7(9)6-4-2-1-3-5-6;2-1(3)4/h1-5H;2H2,(H,3,4) |
| InChIKey | ZSGNWYIXGKIPPX-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 106.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.15 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze carbamic acid;nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamic acid;nitrobenzene?
The IUPAC name of carbamic acid;nitrobenzene (CID 66874578) is carbamic acid;nitrobenzene.
What is the SMILES notation for carbamic acid;nitrobenzene?
The canonical SMILES for carbamic acid;nitrobenzene is NC(=O)O.O=[N+]([O-])c1ccccc1.
What is the InChIKey of carbamic acid;nitrobenzene?
The InChIKey is ZSGNWYIXGKIPPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO2.CH3NO2/c8-7(9)6-4-2-1-3-5-6;2-1(3)4/h1-5H;2H2,(H,3,4).
What are the key properties of carbamic acid;nitrobenzene?
carbamic acid;nitrobenzene has a molecular weight of 184.15 g/mol, XLogP of 1.22, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbamic acid;nitrobenzene is sourced from PubChem (CID 66874578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).