About nitrobenzene;urea
nitrobenzene;urea (PubChem CID 22364416) has the molecular formula C8H13N5O4
and a molecular weight of 243.22 g/mol. Its IUPAC name is nitrobenzene;urea.
Molecular Properties
| Compound Name | nitrobenzene;urea |
| PubChem CID | 22364416 |
| Molecular Formula | C8H13N5O4 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | nitrobenzene;urea |
| SMILES | NC(N)=O.NC(N)=O.O=[N+]([O-])c1ccccc1 |
| InChI | InChI=1S/C6H5NO2.2CH4N2O/c8-7(9)6-4-2-1-3-5-6;2*2-1(3)4/h1-5H;2*(H4,2,3,4) |
| InChIKey | QBSRCMLFHXXLNU-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 181.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze nitrobenzene;urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitrobenzene;urea?
The IUPAC name of nitrobenzene;urea (CID 22364416) is nitrobenzene;urea.
What is the SMILES notation for nitrobenzene;urea?
The canonical SMILES for nitrobenzene;urea is NC(N)=O.NC(N)=O.O=[N+]([O-])c1ccccc1.
What is the InChIKey of nitrobenzene;urea?
The InChIKey is QBSRCMLFHXXLNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO2.2CH4N2O/c8-7(9)6-4-2-1-3-5-6;2*2-1(3)4/h1-5H;2*(H4,2,3,4).
What are the key properties of nitrobenzene;urea?
nitrobenzene;urea has a molecular weight of 243.22 g/mol, XLogP of -0.36, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for nitrobenzene;urea is sourced from PubChem (CID 22364416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).