About 2-hydroxy-2-methylpropanamide;nitrobenzene
2-hydroxy-2-methylpropanamide;nitrobenzene (PubChem CID 174384140) has the molecular formula C10H14N2O4
and a molecular weight of 226.23 g/mol. Its IUPAC name is 2-hydroxy-2-methylpropanamide;nitrobenzene.
Molecular Properties
| Compound Name | 2-hydroxy-2-methylpropanamide;nitrobenzene |
| PubChem CID | 174384140 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 2-hydroxy-2-methylpropanamide;nitrobenzene |
| SMILES | CC(C)(O)C(N)=O.O=[N+]([O-])c1ccccc1 |
| InChI | InChI=1S/C6H5NO2.C4H9NO2/c8-7(9)6-4-2-1-3-5-6;1-4(2,7)3(5)6/h1-5H;7H,1-2H3,(H2,5,6) |
| InChIKey | BEXQSHOOUBXOEO-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 106.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-2-methylpropanamide;nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-2-methylpropanamide;nitrobenzene?
The IUPAC name of 2-hydroxy-2-methylpropanamide;nitrobenzene (CID 174384140) is 2-hydroxy-2-methylpropanamide;nitrobenzene.
What is the SMILES notation for 2-hydroxy-2-methylpropanamide;nitrobenzene?
The canonical SMILES for 2-hydroxy-2-methylpropanamide;nitrobenzene is CC(C)(O)C(N)=O.O=[N+]([O-])c1ccccc1.
What is the InChIKey of 2-hydroxy-2-methylpropanamide;nitrobenzene?
The InChIKey is BEXQSHOOUBXOEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO2.C4H9NO2/c8-7(9)6-4-2-1-3-5-6;1-4(2,7)3(5)6/h1-5H;7H,1-2H3,(H2,5,6).
What are the key properties of 2-hydroxy-2-methylpropanamide;nitrobenzene?
2-hydroxy-2-methylpropanamide;nitrobenzene has a molecular weight of 226.23 g/mol, XLogP of 0.84, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-2-methylpropanamide;nitrobenzene is sourced from PubChem (CID 174384140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).