About nitrobenzene;propanamide
nitrobenzene;propanamide (PubChem CID 91549320) has the molecular formula C9H12N2O3
and a molecular weight of 196.21 g/mol. Its IUPAC name is nitrobenzene;propanamide.
Molecular Properties
| Compound Name | nitrobenzene;propanamide |
| PubChem CID | 91549320 |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | nitrobenzene;propanamide |
| SMILES | CCC(N)=O.O=[N+]([O-])c1ccccc1 |
| InChI | InChI=1S/C6H5NO2.C3H7NO/c8-7(9)6-4-2-1-3-5-6;1-2-3(4)5/h1-5H;2H2,1H3,(H2,4,5) |
| InChIKey | YIUXQHZGYDEPMV-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze nitrobenzene;propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitrobenzene;propanamide?
The IUPAC name of nitrobenzene;propanamide (CID 91549320) is nitrobenzene;propanamide.
What is the SMILES notation for nitrobenzene;propanamide?
The canonical SMILES for nitrobenzene;propanamide is CCC(N)=O.O=[N+]([O-])c1ccccc1.
What is the InChIKey of nitrobenzene;propanamide?
The InChIKey is YIUXQHZGYDEPMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO2.C3H7NO/c8-7(9)6-4-2-1-3-5-6;1-2-3(4)5/h1-5H;2H2,1H3,(H2,4,5).
What are the key properties of nitrobenzene;propanamide?
nitrobenzene;propanamide has a molecular weight of 196.21 g/mol, XLogP of 1.48, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for nitrobenzene;propanamide is sourced from PubChem (CID 91549320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).