About acetyl acetate;nitrobenzene
acetyl acetate;nitrobenzene (PubChem CID 172833883) has the molecular formula C10H11NO5
and a molecular weight of 225.20 g/mol. Its IUPAC name is acetyl acetate;nitrobenzene.
Molecular Properties
| Compound Name | acetyl acetate;nitrobenzene |
| PubChem CID | 172833883 |
| Molecular Formula | C10H11NO5 |
| Molecular Weight | 225.20 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | acetyl acetate;nitrobenzene |
| SMILES | CC(=O)OC(C)=O.O=[N+]([O-])c1ccccc1 |
| InChI | InChI=1S/C6H5NO2.C4H6O3/c8-7(9)6-4-2-1-3-5-6;1-3(5)7-4(2)6/h1-5H;1-2H3 |
| InChIKey | VWRPYJPQVGFOLZ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.20 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze acetyl acetate;nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyl acetate;nitrobenzene?
The IUPAC name of acetyl acetate;nitrobenzene (CID 172833883) is acetyl acetate;nitrobenzene.
What is the SMILES notation for acetyl acetate;nitrobenzene?
The canonical SMILES for acetyl acetate;nitrobenzene is CC(=O)OC(C)=O.O=[N+]([O-])c1ccccc1.
What is the InChIKey of acetyl acetate;nitrobenzene?
The InChIKey is VWRPYJPQVGFOLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO2.C4H6O3/c8-7(9)6-4-2-1-3-5-6;1-3(5)7-4(2)6/h1-5H;1-2H3.
What are the key properties of acetyl acetate;nitrobenzene?
acetyl acetate;nitrobenzene has a molecular weight of 225.20 g/mol, XLogP of 1.69, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for acetyl acetate;nitrobenzene is sourced from PubChem (CID 172833883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).