About nitrobenzene;sulfanol
nitrobenzene;sulfanol (PubChem CID 174553859) has the molecular formula C6H7NO3S
and a molecular weight of 173.19 g/mol. Its IUPAC name is nitrobenzene;sulfanol.
Molecular Properties
| Compound Name | nitrobenzene;sulfanol |
| PubChem CID | 174553859 |
| Molecular Formula | C6H7NO3S |
| Molecular Weight | 173.19 g/mol |
| Exact Mass | 173.01 |
| IUPAC Name | nitrobenzene;sulfanol |
| SMILES | O=[N+]([O-])c1ccccc1.OS |
| InChI | InChI=1S/C6H5NO2.H2OS/c8-7(9)6-4-2-1-3-5-6;1-2/h1-5H;1-2H |
| InChIKey | MLNKYDFTESCFIY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.19 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze nitrobenzene;sulfanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitrobenzene;sulfanol?
The IUPAC name of nitrobenzene;sulfanol (CID 174553859) is nitrobenzene;sulfanol.
What is the SMILES notation for nitrobenzene;sulfanol?
The canonical SMILES for nitrobenzene;sulfanol is O=[N+]([O-])c1ccccc1.OS.
What is the InChIKey of nitrobenzene;sulfanol?
The InChIKey is MLNKYDFTESCFIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO2.H2OS/c8-7(9)6-4-2-1-3-5-6;1-2/h1-5H;1-2H.
What are the key properties of nitrobenzene;sulfanol?
nitrobenzene;sulfanol has a molecular weight of 173.19 g/mol, XLogP of 1.98, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for nitrobenzene;sulfanol is sourced from PubChem (CID 174553859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).