About magnesium;hydride;nitrobenzene
magnesium;hydride;nitrobenzene (PubChem CID 173371093) has the molecular formula C6H7MgNO2
and a molecular weight of 149.43 g/mol. Its IUPAC name is magnesium;hydride;nitrobenzene.
Molecular Properties
| Compound Name | magnesium;hydride;nitrobenzene |
| PubChem CID | 173371093 |
| Molecular Formula | C6H7MgNO2 |
| Molecular Weight | 149.43 g/mol |
| Exact Mass | 149.03 |
| IUPAC Name | magnesium;hydride;nitrobenzene |
| SMILES | O=[N+]([O-])c1ccccc1.[H-].[H-].[Mg+2] |
| InChI | InChI=1S/C6H5NO2.Mg.2H/c8-7(9)6-4-2-1-3-5-6;;;/h1-5H;;;/q;+2;2*-1 |
| InChIKey | MFURSHAYDQBLKA-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.43 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze magnesium;hydride;nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;hydride;nitrobenzene?
The IUPAC name of magnesium;hydride;nitrobenzene (CID 173371093) is magnesium;hydride;nitrobenzene.
What is the SMILES notation for magnesium;hydride;nitrobenzene?
The canonical SMILES for magnesium;hydride;nitrobenzene is O=[N+]([O-])c1ccccc1.[H-].[H-].[Mg+2].
What is the InChIKey of magnesium;hydride;nitrobenzene?
The InChIKey is MFURSHAYDQBLKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO2.Mg.2H/c8-7(9)6-4-2-1-3-5-6;;;/h1-5H;;;/q;+2;2*-1.
What are the key properties of magnesium;hydride;nitrobenzene?
magnesium;hydride;nitrobenzene has a molecular weight of 149.43 g/mol, XLogP of 1.44, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;hydride;nitrobenzene is sourced from PubChem (CID 173371093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).