About calcium nitrobenzene
calcium nitrobenzene (PubChem CID 67916702) has the molecular formula C6H5CaNO2+2
and a molecular weight of 163.19 g/mol. Its IUPAC name is calcium nitrobenzene.
Molecular Properties
| Compound Name | calcium nitrobenzene |
| PubChem CID | 67916702 |
| Molecular Formula | C6H5CaNO2+2 |
| Molecular Weight | 163.19 g/mol |
| Exact Mass | 162.99 |
| IUPAC Name | calcium nitrobenzene |
| SMILES | O=[N+]([O-])c1ccccc1.[Ca+2] |
| InChI | InChI=1S/C6H5NO2.Ca/c8-7(9)6-4-2-1-3-5-6;/h1-5H;/q;+2 |
| InChIKey | UDKMWCGXFKKFJB-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.19 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze calcium nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium nitrobenzene?
The IUPAC name of calcium nitrobenzene (CID 67916702) is calcium nitrobenzene.
What is the SMILES notation for calcium nitrobenzene?
The canonical SMILES for calcium nitrobenzene is O=[N+]([O-])c1ccccc1.[Ca+2].
What is the InChIKey of calcium nitrobenzene?
The InChIKey is UDKMWCGXFKKFJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO2.Ca/c8-7(9)6-4-2-1-3-5-6;/h1-5H;/q;+2.
What are the key properties of calcium nitrobenzene?
calcium nitrobenzene has a molecular weight of 163.19 g/mol, XLogP of 1.21, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for calcium nitrobenzene is sourced from PubChem (CID 67916702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).