About iron;methane;nitrobenzene
iron;methane;nitrobenzene (PubChem CID 175081715) has the molecular formula C7H9FeNO2
and a molecular weight of 195.00 g/mol. Its IUPAC name is iron;methane;nitrobenzene.
Molecular Properties
| Compound Name | iron;methane;nitrobenzene |
| PubChem CID | 175081715 |
| Molecular Formula | C7H9FeNO2 |
| Molecular Weight | 195.00 g/mol |
| Exact Mass | 195.00 |
| IUPAC Name | iron;methane;nitrobenzene |
| SMILES | C.O=[N+]([O-])c1ccccc1.[Fe] |
| InChI | InChI=1S/C6H5NO2.CH4.Fe/c8-7(9)6-4-2-1-3-5-6;;/h1-5H;1H4; |
| InChIKey | FDPWAJLNOKCVKF-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.00 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze iron;methane;nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iron;methane;nitrobenzene?
The IUPAC name of iron;methane;nitrobenzene (CID 175081715) is iron;methane;nitrobenzene.
What is the SMILES notation for iron;methane;nitrobenzene?
The canonical SMILES for iron;methane;nitrobenzene is C.O=[N+]([O-])c1ccccc1.[Fe].
What is the InChIKey of iron;methane;nitrobenzene?
The InChIKey is FDPWAJLNOKCVKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO2.CH4.Fe/c8-7(9)6-4-2-1-3-5-6;;/h1-5H;1H4;.
What are the key properties of iron;methane;nitrobenzene?
iron;methane;nitrobenzene has a molecular weight of 195.00 g/mol, XLogP of 2.23, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for iron;methane;nitrobenzene is sourced from PubChem (CID 175081715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).