About benzenethiol;1,4-dinitrobenzene
benzenethiol;1,4-dinitrobenzene (PubChem CID 174543198) has the molecular formula C12H10N2O4S
and a molecular weight of 278.29 g/mol. Its IUPAC name is benzenethiol;1,4-dinitrobenzene.
Molecular Properties
| Compound Name | benzenethiol;1,4-dinitrobenzene |
| PubChem CID | 174543198 |
| Molecular Formula | C12H10N2O4S |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | benzenethiol;1,4-dinitrobenzene |
| SMILES | O=[N+]([O-])c1ccc([N+](=O)[O-])cc1.Sc1ccccc1 |
| InChI | InChI=1S/C6H4N2O4.C6H6S/c9-7(10)5-1-2-6(4-3-5)8(11)12;7-6-4-2-1-3-5-6/h1-4H;1-5,7H |
| InChIKey | WMXNLTPLLPYDIF-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 86.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze benzenethiol;1,4-dinitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenethiol;1,4-dinitrobenzene?
The IUPAC name of benzenethiol;1,4-dinitrobenzene (CID 174543198) is benzenethiol;1,4-dinitrobenzene.
What is the SMILES notation for benzenethiol;1,4-dinitrobenzene?
The canonical SMILES for benzenethiol;1,4-dinitrobenzene is O=[N+]([O-])c1ccc([N+](=O)[O-])cc1.Sc1ccccc1.
What is the InChIKey of benzenethiol;1,4-dinitrobenzene?
The InChIKey is WMXNLTPLLPYDIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2O4.C6H6S/c9-7(10)5-1-2-6(4-3-5)8(11)12;7-6-4-2-1-3-5-6/h1-4H;1-5,7H.
What are the key properties of benzenethiol;1,4-dinitrobenzene?
benzenethiol;1,4-dinitrobenzene has a molecular weight of 278.29 g/mol, XLogP of 3.48, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzenethiol;1,4-dinitrobenzene is sourced from PubChem (CID 174543198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).