About benzenethiol;ethane;4-methylbenzenethiol
benzenethiol;ethane;4-methylbenzenethiol (PubChem CID 144560916) has the molecular formula C15H20S2
and a molecular weight of 264.46 g/mol. Its IUPAC name is benzenethiol;ethane;4-methylbenzenethiol.
Molecular Properties
| Compound Name | benzenethiol;ethane;4-methylbenzenethiol |
| PubChem CID | 144560916 |
| Molecular Formula | C15H20S2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | benzenethiol;ethane;4-methylbenzenethiol |
| SMILES | CC.Cc1ccc(S)cc1.Sc1ccccc1 |
| InChI | InChI=1S/C7H8S.C6H6S.C2H6/c1-6-2-4-7(8)5-3-6;7-6-4-2-1-3-5-6;1-2/h2-5,8H,1H3;1-5,7H;1-2H3 |
| InChIKey | YHLKIBKVVFGILR-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze benzenethiol;ethane;4-methylbenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenethiol;ethane;4-methylbenzenethiol?
The IUPAC name of benzenethiol;ethane;4-methylbenzenethiol (CID 144560916) is benzenethiol;ethane;4-methylbenzenethiol.
What is the SMILES notation for benzenethiol;ethane;4-methylbenzenethiol?
The canonical SMILES for benzenethiol;ethane;4-methylbenzenethiol is CC.Cc1ccc(S)cc1.Sc1ccccc1.
What is the InChIKey of benzenethiol;ethane;4-methylbenzenethiol?
The InChIKey is YHLKIBKVVFGILR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8S.C6H6S.C2H6/c1-6-2-4-7(8)5-3-6;7-6-4-2-1-3-5-6;1-2/h2-5,8H,1H3;1-5,7H;1-2H3.
What are the key properties of benzenethiol;ethane;4-methylbenzenethiol?
benzenethiol;ethane;4-methylbenzenethiol has a molecular weight of 264.46 g/mol, XLogP of 5.29, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzenethiol;ethane;4-methylbenzenethiol is sourced from PubChem (CID 144560916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).