About 2-ethylbenzenethiol
2-ethylbenzenethiol (PubChem CID 3734338) has the molecular formula C8H10S
and a molecular weight of 138.23 g/mol. Its IUPAC name is 2-ethylbenzenethiol.
Molecular Properties
| Compound Name | 2-ethylbenzenethiol |
| PubChem CID | 3734338 |
| Molecular Formula | C8H10S |
| Molecular Weight | 138.23 g/mol |
| Exact Mass | 138.05 |
| IUPAC Name | 2-ethylbenzenethiol |
| SMILES | CCc1ccccc1S |
| InChI | InChI=1S/C8H10S/c1-2-7-5-3-4-6-8(7)9/h3-6,9H,2H2,1H3 |
| InChIKey | ABROBCBIIWHVNS-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.23 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylbenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylbenzenethiol?
The IUPAC name of 2-ethylbenzenethiol (CID 3734338) is 2-ethylbenzenethiol.
What is the SMILES notation for 2-ethylbenzenethiol?
The canonical SMILES for 2-ethylbenzenethiol is CCc1ccccc1S.
What is the InChIKey of 2-ethylbenzenethiol?
The InChIKey is ABROBCBIIWHVNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10S/c1-2-7-5-3-4-6-8(7)9/h3-6,9H,2H2,1H3.
What are the key properties of 2-ethylbenzenethiol?
2-ethylbenzenethiol has a molecular weight of 138.23 g/mol, XLogP of 2.54, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylbenzenethiol is sourced from PubChem (CID 3734338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).