About ethanol;1-methyl-4-nitrobenzene
ethanol;1-methyl-4-nitrobenzene (PubChem CID 91088173) has the molecular formula C9H13NO3
and a molecular weight of 183.21 g/mol. Its IUPAC name is ethanol;1-methyl-4-nitrobenzene.
Molecular Properties
| Compound Name | ethanol;1-methyl-4-nitrobenzene |
| PubChem CID | 91088173 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | ethanol;1-methyl-4-nitrobenzene |
| SMILES | CCO.Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C7H7NO2.C2H6O/c1-6-2-4-7(5-3-6)8(9)10;1-2-3/h2-5H,1H3;3H,2H2,1H3 |
| InChIKey | QCMDTWJHQZAXKK-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethanol;1-methyl-4-nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;1-methyl-4-nitrobenzene?
The IUPAC name of ethanol;1-methyl-4-nitrobenzene (CID 91088173) is ethanol;1-methyl-4-nitrobenzene.
What is the SMILES notation for ethanol;1-methyl-4-nitrobenzene?
The canonical SMILES for ethanol;1-methyl-4-nitrobenzene is CCO.Cc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of ethanol;1-methyl-4-nitrobenzene?
The InChIKey is QCMDTWJHQZAXKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2.C2H6O/c1-6-2-4-7(5-3-6)8(9)10;1-2-3/h2-5H,1H3;3H,2H2,1H3.
What are the key properties of ethanol;1-methyl-4-nitrobenzene?
ethanol;1-methyl-4-nitrobenzene has a molecular weight of 183.21 g/mol, XLogP of 1.90, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;1-methyl-4-nitrobenzene is sourced from PubChem (CID 91088173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).