C46H36N6O14 — CID 139036987
ethanol;1,2,3,4,5,6-hexakis(4-nitrophenyl)benzene (PubChem CID 139036987) has the molecular formula C46H36N6O14 and a molecular weight of 896.82 g/mol. Its IUPAC name is ethanol;1,2,3,4,5,6-hexakis(4-nitrophenyl)benzene.
| Compound Name | ethanol;1,2,3,4,5,6-hexakis(4-nitrophenyl)benzene |
|---|---|
| PubChem CID | 139036987 |
| Molecular Formula | C46H36N6O14 |
| Molecular Weight | 896.82 g/mol |
| Exact Mass | 896.23 |
| IUPAC Name | ethanol;1,2,3,4,5,6-hexakis(4-nitrophenyl)benzene |
| SMILES | CCO.CCO.O=[N+]([O-])c1ccc(-c2c(-c3ccc([N+](=O)[O-])cc3)c(-c3ccc([N+](=O)[O-])cc3)c(-c3ccc([N+](=O)[O-])cc3)c(-c3ccc([N+](=O)[O-])cc3)c2-c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C42H24N6O12.2C2H6O/c49-43(50)31-13-1-25(2-14-31)37-38(26-3-15-32(16-4-26)44(51)52)40(28-7-19-34(20-8-28)46(55)56)42(30-11-23-36(24-12-30)48(59)60)41(29-9-21-35(22-10-29)47(57)58)39(37)27-5-17-33(18-6-27)45(53)54;2*1-2-3/h1-24H;2*3H,2H2,1H3 |
| InChIKey | YGZGWOAMETUSAY-UHFFFAOYSA-N |
| XLogP | 11.14 |
| TPSA | 299.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 896.82 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|