C42H24N4O8 — CID 71427655
5,6,11,12-tetrakis(4-nitrophenyl)tetracene (PubChem CID 71427655) has the molecular formula C42H24N4O8 and a molecular weight of 712.67 g/mol. Its IUPAC name is 5,6,11,12-tetrakis(4-nitrophenyl)tetracene.
| Compound Name | 5,6,11,12-tetrakis(4-nitrophenyl)tetracene |
|---|---|
| PubChem CID | 71427655 |
| Molecular Formula | C42H24N4O8 |
| Molecular Weight | 712.67 g/mol |
| Exact Mass | 712.16 |
| IUPAC Name | 5,6,11,12-tetrakis(4-nitrophenyl)tetracene |
| SMILES | O=[N+]([O-])c1ccc(-c2c3ccccc3c(-c3ccc([N+](=O)[O-])cc3)c3c(-c4ccc([N+](=O)[O-])cc4)c4ccccc4c(-c4ccc([N+](=O)[O-])cc4)c23)cc1 |
| InChI | InChI=1S/C42H24N4O8/c47-43(48)29-17-9-25(10-18-29)37-33-5-1-2-6-34(33)38(26-11-19-30(20-12-26)44(49)50)42-40(28-15-23-32(24-16-28)46(53)54)36-8-4-3-7-35(36)39(41(37)42)27-13-21-31(22-14-27)45(51)52/h1-24H |
| InChIKey | RWOUECQPRLSSHW-UHFFFAOYSA-N |
| XLogP | 11.45 |
| TPSA | 172.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.67 |
| LogP ≤ 5 | 11.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|