C18H24N2O3 — CID 154178146
4-[3-ethyl-2,5-dimethyl-4-(4-nitrophenyl)pyrrol-1-yl]butan-1-ol (PubChem CID 154178146) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is 4-[3-ethyl-2,5-dimethyl-4-(4-nitrophenyl)pyrrol-1-yl]butan-1-ol.
| Compound Name | 4-[3-ethyl-2,5-dimethyl-4-(4-nitrophenyl)pyrrol-1-yl]butan-1-ol |
|---|---|
| PubChem CID | 154178146 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 4-[3-ethyl-2,5-dimethyl-4-(4-nitrophenyl)pyrrol-1-yl]butan-1-ol |
| SMILES | CCc1c(-c2ccc([N+](=O)[O-])cc2)c(C)n(CCCCO)c1C |
| InChI | InChI=1S/C18H24N2O3/c1-4-17-13(2)19(11-5-6-12-21)14(3)18(17)15-7-9-16(10-8-15)20(22)23/h7-10,21H,4-6,11-12H2,1-3H3 |
| InChIKey | MAXVTCYBDPSVDF-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|