C19H19NO7 — CID 46894891
1-O-ethyl 4-O-methyl 2-ethyl-3-hydroxy-5-(4-nitrophenyl)benzene-1,4-dicarboxylate (PubChem CID 46894891) has the molecular formula C19H19NO7 and a molecular weight of 373.36 g/mol. Its IUPAC name is 1-O-ethyl 4-O-methyl 2-ethyl-3-hydroxy-5-(4-nitrophenyl)benzene-1,4-dicarboxylate.
| Compound Name | 1-O-ethyl 4-O-methyl 2-ethyl-3-hydroxy-5-(4-nitrophenyl)benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 46894891 |
| Molecular Formula | C19H19NO7 |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 1-O-ethyl 4-O-methyl 2-ethyl-3-hydroxy-5-(4-nitrophenyl)benzene-1,4-dicarboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccc([N+](=O)[O-])cc2)c(C(=O)OC)c(O)c1CC |
| InChI | InChI=1S/C19H19NO7/c1-4-13-15(18(22)27-5-2)10-14(16(17(13)21)19(23)26-3)11-6-8-12(9-7-11)20(24)25/h6-10,21H,4-5H2,1-3H3 |
| InChIKey | GKQWRIRAZAFHIT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|