C19H14N2O7 — CID 44632724
ethyl 2,5-bis(4-nitrophenyl)furan-3-carboxylate (PubChem CID 44632724) has the molecular formula C19H14N2O7 and a molecular weight of 382.33 g/mol. Its IUPAC name is ethyl 2,5-bis(4-nitrophenyl)furan-3-carboxylate.
| Compound Name | ethyl 2,5-bis(4-nitrophenyl)furan-3-carboxylate |
|---|---|
| PubChem CID | 44632724 |
| Molecular Formula | C19H14N2O7 |
| Molecular Weight | 382.33 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | ethyl 2,5-bis(4-nitrophenyl)furan-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccc([N+](=O)[O-])cc2)oc1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H14N2O7/c1-2-27-19(22)16-11-17(12-3-7-14(8-4-12)20(23)24)28-18(16)13-5-9-15(10-6-13)21(25)26/h3-11H,2H2,1H3 |
| InChIKey | IKZQRRUOHHFVFN-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 125.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.33 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|