C16H15NO7 — CID 164671795
diethyl 5-(4-nitrophenyl)furan-2,3-dicarboxylate (PubChem CID 164671795) has the molecular formula C16H15NO7 and a molecular weight of 333.30 g/mol. Its IUPAC name is diethyl 5-(4-nitrophenyl)furan-2,3-dicarboxylate.
| Compound Name | diethyl 5-(4-nitrophenyl)furan-2,3-dicarboxylate |
|---|---|
| PubChem CID | 164671795 |
| Molecular Formula | C16H15NO7 |
| Molecular Weight | 333.30 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | diethyl 5-(4-nitrophenyl)furan-2,3-dicarboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccc([N+](=O)[O-])cc2)oc1C(=O)OCC |
| InChI | InChI=1S/C16H15NO7/c1-3-22-15(18)12-9-13(24-14(12)16(19)23-4-2)10-5-7-11(8-6-10)17(20)21/h5-9H,3-4H2,1-2H3 |
| InChIKey | GPGCZDUMAPNYTG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 108.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.30 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|