C16H16N2O6 — CID 134695151
diethyl 3-(4-nitrophenyl)-1H-pyrrole-2,4-dicarboxylate (PubChem CID 134695151) has the molecular formula C16H16N2O6 and a molecular weight of 332.31 g/mol. Its IUPAC name is diethyl 3-(4-nitrophenyl)-1H-pyrrole-2,4-dicarboxylate.
| Compound Name | diethyl 3-(4-nitrophenyl)-1H-pyrrole-2,4-dicarboxylate |
|---|---|
| PubChem CID | 134695151 |
| Molecular Formula | C16H16N2O6 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | diethyl 3-(4-nitrophenyl)-1H-pyrrole-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1c[nH]c(C(=O)OCC)c1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H16N2O6/c1-3-23-15(19)12-9-17-14(16(20)24-4-2)13(12)10-5-7-11(8-6-10)18(21)22/h5-9,17H,3-4H2,1-2H3 |
| InChIKey | YRHMASXVZMECRA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|