C18H19N3O7 — CID 139229156
ethyl 3-(3-acetyloxy-2-methylpropanoyl)-4-(4-nitrophenyl)-1H-pyrazole-5-carboxylate (PubChem CID 139229156) has the molecular formula C18H19N3O7 and a molecular weight of 389.36 g/mol. Its IUPAC name is ethyl 3-(3-acetyloxy-2-methylpropanoyl)-4-(4-nitrophenyl)-1H-pyrazole-5-carboxylate.
| Compound Name | ethyl 3-(3-acetyloxy-2-methylpropanoyl)-4-(4-nitrophenyl)-1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 139229156 |
| Molecular Formula | C18H19N3O7 |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | ethyl 3-(3-acetyloxy-2-methylpropanoyl)-4-(4-nitrophenyl)-1H-pyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1[nH]nc(C(=O)C(C)COC(C)=O)c1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H19N3O7/c1-4-27-18(24)16-14(12-5-7-13(8-6-12)21(25)26)15(19-20-16)17(23)10(2)9-28-11(3)22/h5-8,10H,4,9H2,1-3H3,(H,19,20) |
| InChIKey | LPPYPJAGAHPTAO-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 141.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|