C12H10N2O5 — CID 44542997
ethyl 4-(4-nitrophenyl)-1,3-oxazole-5-carboxylate (PubChem CID 44542997) has the molecular formula C12H10N2O5 and a molecular weight of 262.22 g/mol. Its IUPAC name is ethyl 4-(4-nitrophenyl)-1,3-oxazole-5-carboxylate.
| Compound Name | ethyl 4-(4-nitrophenyl)-1,3-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 44542997 |
| Molecular Formula | C12H10N2O5 |
| Molecular Weight | 262.22 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | ethyl 4-(4-nitrophenyl)-1,3-oxazole-5-carboxylate |
| SMILES | CCOC(=O)c1ocnc1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H10N2O5/c1-2-18-12(15)11-10(13-7-19-11)8-3-5-9(6-4-8)14(16)17/h3-7H,2H2,1H3 |
| InChIKey | BATOAWGZWCUJCY-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 95.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.22 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|