C11H10N4O4 — CID 134096704
ethyl 1-(4-nitrophenyl)-1,2,4-triazole-3-carboxylate (PubChem CID 134096704) has the molecular formula C11H10N4O4 and a molecular weight of 262.23 g/mol. Its IUPAC name is ethyl 1-(4-nitrophenyl)-1,2,4-triazole-3-carboxylate.
| Compound Name | ethyl 1-(4-nitrophenyl)-1,2,4-triazole-3-carboxylate |
|---|---|
| PubChem CID | 134096704 |
| Molecular Formula | C11H10N4O4 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | ethyl 1-(4-nitrophenyl)-1,2,4-triazole-3-carboxylate |
| SMILES | CCOC(=O)c1ncn(-c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C11H10N4O4/c1-2-19-11(16)10-12-7-14(13-10)8-3-5-9(6-4-8)15(17)18/h3-7H,2H2,1H3 |
| InChIKey | OFRNCNGLNRTDFR-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 100.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|