C19H16N4O7 — CID 55753619
ethyl 1-(4-nitrophenyl)-4-[(3-nitrophenyl)methoxy]pyrazole-3-carboxylate (PubChem CID 55753619) has the molecular formula C19H16N4O7 and a molecular weight of 412.36 g/mol. Its IUPAC name is ethyl 1-(4-nitrophenyl)-4-[(3-nitrophenyl)methoxy]pyrazole-3-carboxylate.
| Compound Name | ethyl 1-(4-nitrophenyl)-4-[(3-nitrophenyl)methoxy]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 55753619 |
| Molecular Formula | C19H16N4O7 |
| Molecular Weight | 412.36 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | ethyl 1-(4-nitrophenyl)-4-[(3-nitrophenyl)methoxy]pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1nn(-c2ccc([N+](=O)[O-])cc2)cc1OCc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H16N4O7/c1-2-29-19(24)18-17(30-12-13-4-3-5-16(10-13)23(27)28)11-21(20-18)14-6-8-15(9-7-14)22(25)26/h3-11H,2,12H2,1H3 |
| InChIKey | GWRYVBLNDXNDEG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 139.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.36 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|